C18H15N3O3 — CID 133481744
N,N-bis(furan-2-ylmethyl)-5-phenyl-1,2,4-oxadiazol-3-amine (PubChem CID 133481744) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is N,N-bis(furan-2-ylmethyl)-5-phenyl-1,2,4-oxadiazol-3-amine.
| Compound Name | N,N-bis(furan-2-ylmethyl)-5-phenyl-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 133481744 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N,N-bis(furan-2-ylmethyl)-5-phenyl-1,2,4-oxadiazol-3-amine |
| SMILES | c1ccc(-c2nc(N(Cc3ccco3)Cc3ccco3)no2)cc1 |
| InChI | InChI=1S/C18H15N3O3/c1-2-6-14(7-3-1)17-19-18(20-24-17)21(12-15-8-4-10-22-15)13-16-9-5-11-23-16/h1-11H,12-13H2 |
| InChIKey | QMYGPIRIZBBDCM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 68.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |