C24H20N6O3 — CID 3807082
4-methoxy-N-[(3-oxo-2-phenyl-4-phenyldiazenyl-1H-pyrazol-5-yl)methylideneamino]benzamide (PubChem CID 3807082) has the molecular formula C24H20N6O3 and a molecular weight of 440.46 g/mol. Its IUPAC name is 4-methoxy-N-[(3-oxo-2-phenyl-4-phenyldiazenyl-1H-pyrazol-5-yl)methylideneamino]benzamide.
| Compound Name | 4-methoxy-N-[(3-oxo-2-phenyl-4-phenyldiazenyl-1H-pyrazol-5-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 3807082 |
| Molecular Formula | C24H20N6O3 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 4-methoxy-N-[(3-oxo-2-phenyl-4-phenyldiazenyl-1H-pyrazol-5-yl)methylideneamino]benzamide |
| SMILES | COc1ccc(C(=O)NN=Cc2[nH]n(-c3ccccc3)c(=O)c2/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20N6O3/c1-33-20-14-12-17(13-15-20)23(31)28-25-16-21-22(27-26-18-8-4-2-5-9-18)24(32)30(29-21)19-10-6-3-7-11-19/h2-16,29H,1H3,(H,28,31)/b25-16?,27-26+ |
| InChIKey | ICWQTJCCQYZKMS-XVSUMCTESA-N |
| XLogP | 4.35 |
| TPSA | 113.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|