C24H28ClN3O — CID 3807697
1-[2-(3-chlorophenyl)ethyl]-5-[4-(diethylamino)phenyl]-2-methylpyrrole-3-carboxamide (PubChem CID 3807697) has the molecular formula C24H28ClN3O and a molecular weight of 409.96 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-5-[4-(diethylamino)phenyl]-2-methylpyrrole-3-carboxamide.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-5-[4-(diethylamino)phenyl]-2-methylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3807697 |
| Molecular Formula | C24H28ClN3O |
| Molecular Weight | 409.96 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-5-[4-(diethylamino)phenyl]-2-methylpyrrole-3-carboxamide |
| SMILES | CCN(CC)c1ccc(-c2cc(C(N)=O)c(C)n2CCc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C24H28ClN3O/c1-4-27(5-2)21-11-9-19(10-12-21)23-16-22(24(26)29)17(3)28(23)14-13-18-7-6-8-20(25)15-18/h6-12,15-16H,4-5,13-14H2,1-3H3,(H2,26,29) |
| InChIKey | IFVUKSLGHVUTNW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.96 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|