C23H18F3N3S — CID 3809140
[2-[(3-methylphenyl)methylsulfanyl]-1H-indol-3-yl]-[3-(trifluoromethyl)phenyl]diazene (PubChem CID 3809140) has the molecular formula C23H18F3N3S and a molecular weight of 425.48 g/mol. Its IUPAC name is [2-[(3-methylphenyl)methylsulfanyl]-1H-indol-3-yl]-[3-(trifluoromethyl)phenyl]diazene.
| Compound Name | [2-[(3-methylphenyl)methylsulfanyl]-1H-indol-3-yl]-[3-(trifluoromethyl)phenyl]diazene |
|---|---|
| PubChem CID | 3809140 |
| Molecular Formula | C23H18F3N3S |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | [2-[(3-methylphenyl)methylsulfanyl]-1H-indol-3-yl]-[3-(trifluoromethyl)phenyl]diazene |
| SMILES | Cc1cccc(CSc2[nH]c3ccccc3c2/N=N/c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C23H18F3N3S/c1-15-6-4-7-16(12-15)14-30-22-21(19-10-2-3-11-20(19)27-22)29-28-18-9-5-8-17(13-18)23(24,25)26/h2-13,27H,14H2,1H3/b29-28+ |
| InChIKey | XORSLGLUWLCWKL-ZQHSETAFSA-N |
| XLogP | 8.20 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|