C17H16ClN3O6S — CID 38105006
(2R)-N-(2-chloro-5-nitrophenyl)-5-methylsulfonyl-3,4-dihydro-2H-1,5-benzoxazepine-2-carboxamide (PubChem CID 38105006) has the molecular formula C17H16ClN3O6S and a molecular weight of 425.85 g/mol. Its IUPAC name is (2R)-N-(2-chloro-5-nitrophenyl)-5-methylsulfonyl-3,4-dihydro-2H-1,5-benzoxazepine-2-carboxamide.
| Compound Name | (2R)-N-(2-chloro-5-nitrophenyl)-5-methylsulfonyl-3,4-dihydro-2H-1,5-benzoxazepine-2-carboxamide |
|---|---|
| PubChem CID | 38105006 |
| Molecular Formula | C17H16ClN3O6S |
| Molecular Weight | 425.85 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | (2R)-N-(2-chloro-5-nitrophenyl)-5-methylsulfonyl-3,4-dihydro-2H-1,5-benzoxazepine-2-carboxamide |
| SMILES | CS(=O)(=O)N1CC[C@H](C(=O)Nc2cc([N+](=O)[O-])ccc2Cl)Oc2ccccc21 |
| InChI | InChI=1S/C17H16ClN3O6S/c1-28(25,26)20-9-8-16(27-15-5-3-2-4-14(15)20)17(22)19-13-10-11(21(23)24)6-7-12(13)18/h2-7,10,16H,8-9H2,1H3,(H,19,22)/t16-/m1/s1 |
| InChIKey | ATHKUILVTAYZPM-MRXNPFEDSA-N |
| XLogP | 2.80 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.85 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|