C16H16N2O6 — CID 38112763
2,3,4-trimethoxy-N-(2-nitrophenyl)benzamide (PubChem CID 38112763) has the molecular formula C16H16N2O6 and a molecular weight of 332.31 g/mol. Its IUPAC name is 2,3,4-trimethoxy-N-(2-nitrophenyl)benzamide.
| Compound Name | 2,3,4-trimethoxy-N-(2-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 38112763 |
| Molecular Formula | C16H16N2O6 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 2,3,4-trimethoxy-N-(2-nitrophenyl)benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2[N+](=O)[O-])c(OC)c1OC |
| InChI | InChI=1S/C16H16N2O6/c1-22-13-9-8-10(14(23-2)15(13)24-3)16(19)17-11-6-4-5-7-12(11)18(20)21/h4-9H,1-3H3,(H,17,19) |
| InChIKey | RXCFJBFSTUBUBF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|