C14H9F3N2O4 — CID 110317070
2,3,4-trifluoro-N-(2-methoxyphenyl)-5-nitrobenzamide (PubChem CID 110317070) has the molecular formula C14H9F3N2O4 and a molecular weight of 326.23 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-(2-methoxyphenyl)-5-nitrobenzamide.
| Compound Name | 2,3,4-trifluoro-N-(2-methoxyphenyl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 110317070 |
| Molecular Formula | C14H9F3N2O4 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 2,3,4-trifluoro-N-(2-methoxyphenyl)-5-nitrobenzamide |
| SMILES | COc1ccccc1NC(=O)c1cc([N+](=O)[O-])c(F)c(F)c1F |
| InChI | InChI=1S/C14H9F3N2O4/c1-23-10-5-3-2-4-8(10)18-14(20)7-6-9(19(21)22)12(16)13(17)11(7)15/h2-6H,1H3,(H,18,20) |
| InChIKey | UGQGDXSQIJCPNU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|