C15H10F3N3O4 — CID 110317083
N-(3-acetamidophenyl)-2,3,4-trifluoro-5-nitrobenzamide (PubChem CID 110317083) has the molecular formula C15H10F3N3O4 and a molecular weight of 353.26 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-2,3,4-trifluoro-5-nitrobenzamide.
| Compound Name | N-(3-acetamidophenyl)-2,3,4-trifluoro-5-nitrobenzamide |
|---|---|
| PubChem CID | 110317083 |
| Molecular Formula | C15H10F3N3O4 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | N-(3-acetamidophenyl)-2,3,4-trifluoro-5-nitrobenzamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)c2cc([N+](=O)[O-])c(F)c(F)c2F)c1 |
| InChI | InChI=1S/C15H10F3N3O4/c1-7(22)19-8-3-2-4-9(5-8)20-15(23)10-6-11(21(24)25)13(17)14(18)12(10)16/h2-6H,1H3,(H,19,22)(H,20,23) |
| InChIKey | GBQULOANKUFRDG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|