C15H8ClF3N2O5 — CID 110313358
methyl 2-chloro-5-[(2,3,4-trifluoro-5-nitrobenzoyl)amino]benzoate (PubChem CID 110313358) has the molecular formula C15H8ClF3N2O5 and a molecular weight of 388.69 g/mol. Its IUPAC name is methyl 2-chloro-5-[(2,3,4-trifluoro-5-nitrobenzoyl)amino]benzoate.
| Compound Name | methyl 2-chloro-5-[(2,3,4-trifluoro-5-nitrobenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 110313358 |
| Molecular Formula | C15H8ClF3N2O5 |
| Molecular Weight | 388.69 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | methyl 2-chloro-5-[(2,3,4-trifluoro-5-nitrobenzoyl)amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)c2cc([N+](=O)[O-])c(F)c(F)c2F)ccc1Cl |
| InChI | InChI=1S/C15H8ClF3N2O5/c1-26-15(23)7-4-6(2-3-9(7)16)20-14(22)8-5-10(21(24)25)12(18)13(19)11(8)17/h2-5H,1H3,(H,20,22) |
| InChIKey | NICKUNKPSQDFMF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.69 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|