C18H15ClN4O3S2 — CID 38113621
2-[[5-[(2-chlorophenyl)sulfanylmethyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-1-(4-nitrophenyl)ethanone (PubChem CID 38113621) has the molecular formula C18H15ClN4O3S2 and a molecular weight of 434.93 g/mol. Its IUPAC name is 2-[[5-[(2-chlorophenyl)sulfanylmethyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-1-(4-nitrophenyl)ethanone.
| Compound Name | 2-[[5-[(2-chlorophenyl)sulfanylmethyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-1-(4-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 38113621 |
| Molecular Formula | C18H15ClN4O3S2 |
| Molecular Weight | 434.93 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | 2-[[5-[(2-chlorophenyl)sulfanylmethyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-1-(4-nitrophenyl)ethanone |
| SMILES | Cn1c(CSc2ccccc2Cl)nnc1SCC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H15ClN4O3S2/c1-22-17(11-27-16-5-3-2-4-14(16)19)20-21-18(22)28-10-15(24)12-6-8-13(9-7-12)23(25)26/h2-9H,10-11H2,1H3 |
| InChIKey | OKIAVMCWDLPIAO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 90.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.93 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|