C20H18Cl2N4O4S — CID 2980605
2-[[5-[3-(2,4-dichlorophenoxy)propyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-1-(3-nitrophenyl)ethanone (PubChem CID 2980605) has the molecular formula C20H18Cl2N4O4S and a molecular weight of 481.36 g/mol. Its IUPAC name is 2-[[5-[3-(2,4-dichlorophenoxy)propyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-1-(3-nitrophenyl)ethanone.
| Compound Name | 2-[[5-[3-(2,4-dichlorophenoxy)propyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-1-(3-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 2980605 |
| Molecular Formula | C20H18Cl2N4O4S |
| Molecular Weight | 481.36 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | 2-[[5-[3-(2,4-dichlorophenoxy)propyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-1-(3-nitrophenyl)ethanone |
| SMILES | Cn1c(CCCOc2ccc(Cl)cc2Cl)nnc1SCC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H18Cl2N4O4S/c1-25-19(6-3-9-30-18-8-7-14(21)11-16(18)22)23-24-20(25)31-12-17(27)13-4-2-5-15(10-13)26(28)29/h2,4-5,7-8,10-11H,3,6,9,12H2,1H3 |
| InChIKey | QLBQGXCJZAIXHK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 100.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.36 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|