C20H18FN5O4S — CID 4291407
N-(2-fluorophenyl)-3-[4-methyl-5-[2-(3-nitrophenyl)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propanamide (PubChem CID 4291407) has the molecular formula C20H18FN5O4S and a molecular weight of 443.46 g/mol. Its IUPAC name is N-(2-fluorophenyl)-3-[4-methyl-5-[2-(3-nitrophenyl)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propanamide.
| Compound Name | N-(2-fluorophenyl)-3-[4-methyl-5-[2-(3-nitrophenyl)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propanamide |
|---|---|
| PubChem CID | 4291407 |
| Molecular Formula | C20H18FN5O4S |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | N-(2-fluorophenyl)-3-[4-methyl-5-[2-(3-nitrophenyl)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propanamide |
| SMILES | Cn1c(CCC(=O)Nc2ccccc2F)nnc1SCC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H18FN5O4S/c1-25-18(9-10-19(28)22-16-8-3-2-7-15(16)21)23-24-20(25)31-12-17(27)13-5-4-6-14(11-13)26(29)30/h2-8,11H,9-10,12H2,1H3,(H,22,28) |
| InChIKey | GEZWDXQPWVLJCF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|