C21H20FN5O4S — CID 5112609
N-[3-[4-(2-fluorophenyl)-5-[2-(3-nitrophenyl)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]acetamide (PubChem CID 5112609) has the molecular formula C21H20FN5O4S and a molecular weight of 457.49 g/mol. Its IUPAC name is N-[3-[4-(2-fluorophenyl)-5-[2-(3-nitrophenyl)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]acetamide.
| Compound Name | N-[3-[4-(2-fluorophenyl)-5-[2-(3-nitrophenyl)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]acetamide |
|---|---|
| PubChem CID | 5112609 |
| Molecular Formula | C21H20FN5O4S |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | N-[3-[4-(2-fluorophenyl)-5-[2-(3-nitrophenyl)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]acetamide |
| SMILES | CC(=O)NCCCc1nnc(SCC(=O)c2cccc([N+](=O)[O-])c2)n1-c1ccccc1F |
| InChI | InChI=1S/C21H20FN5O4S/c1-14(28)23-11-5-10-20-24-25-21(26(20)18-9-3-2-8-17(18)22)32-13-19(29)15-6-4-7-16(12-15)27(30)31/h2-4,6-9,12H,5,10-11,13H2,1H3,(H,23,28) |
| InChIKey | UXBLCOFISONMBR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|