C21H21N5O5S — CID 4112446
N-[2-[4-(2-methoxyphenyl)-5-[2-(3-nitrophenyl)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]acetamide (PubChem CID 4112446) has the molecular formula C21H21N5O5S and a molecular weight of 455.50 g/mol. Its IUPAC name is N-[2-[4-(2-methoxyphenyl)-5-[2-(3-nitrophenyl)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]acetamide.
| Compound Name | N-[2-[4-(2-methoxyphenyl)-5-[2-(3-nitrophenyl)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 4112446 |
| Molecular Formula | C21H21N5O5S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | N-[2-[4-(2-methoxyphenyl)-5-[2-(3-nitrophenyl)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]acetamide |
| SMILES | COc1ccccc1-n1c(CCNC(C)=O)nnc1SCC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H21N5O5S/c1-14(27)22-11-10-20-23-24-21(25(20)17-8-3-4-9-19(17)31-2)32-13-18(28)15-6-5-7-16(12-15)26(29)30/h3-9,12H,10-11,13H2,1-2H3,(H,22,27) |
| InChIKey | DYZZVUGBDOKPBO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 129.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|