C20H20N4O5S — CID 4533858
2-[[4-ethyl-5-[(2-methoxyphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-1-(3-nitrophenyl)ethanone (PubChem CID 4533858) has the molecular formula C20H20N4O5S and a molecular weight of 428.47 g/mol. Its IUPAC name is 2-[[4-ethyl-5-[(2-methoxyphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-1-(3-nitrophenyl)ethanone.
| Compound Name | 2-[[4-ethyl-5-[(2-methoxyphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-1-(3-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 4533858 |
| Molecular Formula | C20H20N4O5S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 2-[[4-ethyl-5-[(2-methoxyphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-1-(3-nitrophenyl)ethanone |
| SMILES | CCn1c(COc2ccccc2OC)nnc1SCC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H20N4O5S/c1-3-23-19(12-29-18-10-5-4-9-17(18)28-2)21-22-20(23)30-13-16(25)14-7-6-8-15(11-14)24(26)27/h4-11H,3,12-13H2,1-2H3 |
| InChIKey | QVBGHRIMTFJQDW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 109.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|