C21H24Cl2N6O3S2 — CID 17302634
2-[[2-[[5-[3-(2,4-dichlorophenoxy)propyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide (PubChem CID 17302634) has the molecular formula C21H24Cl2N6O3S2 and a molecular weight of 543.50 g/mol. Its IUPAC name is 2-[[2-[[5-[3-(2,4-dichlorophenoxy)propyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[[2-[[5-[3-(2,4-dichlorophenoxy)propyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 17302634 |
| Molecular Formula | C21H24Cl2N6O3S2 |
| Molecular Weight | 543.50 g/mol |
| Exact Mass | 542.07 |
| IUPAC Name | 2-[[2-[[5-[3-(2,4-dichlorophenoxy)propyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(NC(=O)CSc2nnc(CCCOc3ccc(Cl)cc3Cl)n2C)sc1C(=O)N(C)C |
| InChI | InChI=1S/C21H24Cl2N6O3S2/c1-12-18(19(31)28(2)3)34-20(24-12)25-17(30)11-33-21-27-26-16(29(21)4)6-5-9-32-15-8-7-13(22)10-14(15)23/h7-8,10H,5-6,9,11H2,1-4H3,(H,24,25,30) |
| InChIKey | MWBGEQBSBWKSSO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|