C21H22ClFN6O3S2 — CID 17304350
2-[[2-[[5-[(3-chloro-4-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide (PubChem CID 17304350) has the molecular formula C21H22ClFN6O3S2 and a molecular weight of 525.03 g/mol. Its IUPAC name is 2-[[2-[[5-[(3-chloro-4-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[[2-[[5-[(3-chloro-4-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 17304350 |
| Molecular Formula | C21H22ClFN6O3S2 |
| Molecular Weight | 525.03 g/mol |
| Exact Mass | 524.09 |
| IUPAC Name | 2-[[2-[[5-[(3-chloro-4-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
| SMILES | C=CCn1c(COc2ccc(F)c(Cl)c2)nnc1SCC(=O)Nc1nc(C)c(C(=O)N(C)C)s1 |
| InChI | InChI=1S/C21H22ClFN6O3S2/c1-5-8-29-16(10-32-13-6-7-15(23)14(22)9-13)26-27-21(29)33-11-17(30)25-20-24-12(2)18(34-20)19(31)28(3)4/h5-7,9H,1,8,10-11H2,2-4H3,(H,24,25,30) |
| InChIKey | CRLOLGOBUDVGLQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.03 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|