C20H25N7O2S2 — CID 17303729
N,N,4-trimethyl-2-[[2-[[5-[(1-methylpyrrol-2-yl)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 17303729) has the molecular formula C20H25N7O2S2 and a molecular weight of 459.60 g/mol. Its IUPAC name is N,N,4-trimethyl-2-[[2-[[5-[(1-methylpyrrol-2-yl)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N,N,4-trimethyl-2-[[2-[[5-[(1-methylpyrrol-2-yl)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 17303729 |
| Molecular Formula | C20H25N7O2S2 |
| Molecular Weight | 459.60 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | N,N,4-trimethyl-2-[[2-[[5-[(1-methylpyrrol-2-yl)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | C=CCn1c(Cc2cccn2C)nnc1SCC(=O)Nc1nc(C)c(C(=O)N(C)C)s1 |
| InChI | InChI=1S/C20H25N7O2S2/c1-6-9-27-15(11-14-8-7-10-26(14)5)23-24-20(27)30-12-16(28)22-19-21-13(2)17(31-19)18(29)25(3)4/h6-8,10H,1,9,11-12H2,2-5H3,(H,21,22,28) |
| InChIKey | CBXLOAKECVXKAQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 97.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.60 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|