C18H22ClN3O3S — CID 4536187
2-[4-(4-chloro-2-methylphenoxy)butanoylamino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide (PubChem CID 4536187) has the molecular formula C18H22ClN3O3S and a molecular weight of 395.91 g/mol. Its IUPAC name is 2-[4-(4-chloro-2-methylphenoxy)butanoylamino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[4-(4-chloro-2-methylphenoxy)butanoylamino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 4536187 |
| Molecular Formula | C18H22ClN3O3S |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 2-[4-(4-chloro-2-methylphenoxy)butanoylamino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1cc(Cl)ccc1OCCCC(=O)Nc1nc(C)c(C(=O)N(C)C)s1 |
| InChI | InChI=1S/C18H22ClN3O3S/c1-11-10-13(19)7-8-14(11)25-9-5-6-15(23)21-18-20-12(2)16(26-18)17(24)22(3)4/h7-8,10H,5-6,9H2,1-4H3,(H,20,21,23) |
| InChIKey | NPTGRWLRNSOWOX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|