C17H20ClN3O4 — CID 3981746
4-(4-chloro-2-methylphenoxy)-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)butanamide (PubChem CID 3981746) has the molecular formula C17H20ClN3O4 and a molecular weight of 365.82 g/mol. Its IUPAC name is 4-(4-chloro-2-methylphenoxy)-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)butanamide.
| Compound Name | 4-(4-chloro-2-methylphenoxy)-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)butanamide |
|---|---|
| PubChem CID | 3981746 |
| Molecular Formula | C17H20ClN3O4 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 4-(4-chloro-2-methylphenoxy)-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)butanamide |
| SMILES | Cc1cc(Cl)ccc1OCCCC(=O)Nc1cc(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C17H20ClN3O4/c1-11-9-12(18)6-7-13(11)25-8-4-5-15(22)19-14-10-16(23)21(3)17(24)20(14)2/h6-7,9-10H,4-5,8H2,1-3H3,(H,19,22) |
| InChIKey | KVYMQCACWHVGOK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|