C26H31N5O4 — CID 38115317
N-[2-(3-methoxypropylcarbamoyl)phenyl]-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-4-carboxamide (PubChem CID 38115317) has the molecular formula C26H31N5O4 and a molecular weight of 477.57 g/mol. Its IUPAC name is N-[2-(3-methoxypropylcarbamoyl)phenyl]-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-4-carboxamide.
| Compound Name | N-[2-(3-methoxypropylcarbamoyl)phenyl]-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 38115317 |
| Molecular Formula | C26H31N5O4 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | N-[2-(3-methoxypropylcarbamoyl)phenyl]-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-4-carboxamide |
| SMILES | COCCCNC(=O)c1ccccc1NC(=O)C1CCN(Cc2nc(-c3ccccc3)no2)CC1 |
| InChI | InChI=1S/C26H31N5O4/c1-34-17-7-14-27-26(33)21-10-5-6-11-22(21)28-25(32)20-12-15-31(16-13-20)18-23-29-24(30-35-23)19-8-3-2-4-9-19/h2-6,8-11,20H,7,12-18H2,1H3,(H,27,33)(H,28,32) |
| InChIKey | XMZVJRUBYZDZHU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 109.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|