C26H30ClN5O3 — CID 38153961
N-[2-(butylcarbamoyl)phenyl]-1-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-4-carboxamide (PubChem CID 38153961) has the molecular formula C26H30ClN5O3 and a molecular weight of 496.01 g/mol. Its IUPAC name is N-[2-(butylcarbamoyl)phenyl]-1-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-4-carboxamide.
| Compound Name | N-[2-(butylcarbamoyl)phenyl]-1-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 38153961 |
| Molecular Formula | C26H30ClN5O3 |
| Molecular Weight | 496.01 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | N-[2-(butylcarbamoyl)phenyl]-1-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-4-carboxamide |
| SMILES | CCCCNC(=O)c1ccccc1NC(=O)C1CCN(Cc2nc(-c3ccccc3Cl)no2)CC1 |
| InChI | InChI=1S/C26H30ClN5O3/c1-2-3-14-28-26(34)20-9-5-7-11-22(20)29-25(33)18-12-15-32(16-13-18)17-23-30-24(31-35-23)19-8-4-6-10-21(19)27/h4-11,18H,2-3,12-17H2,1H3,(H,28,34)(H,29,33) |
| InChIKey | PJFYFIPEKANNJX-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.01 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|