C24H29Cl2N3O2 — CID 38097310
N-[2-(butylcarbamoyl)phenyl]-1-[(2,4-dichlorophenyl)methyl]piperidine-4-carboxamide (PubChem CID 38097310) has the molecular formula C24H29Cl2N3O2 and a molecular weight of 462.42 g/mol. Its IUPAC name is N-[2-(butylcarbamoyl)phenyl]-1-[(2,4-dichlorophenyl)methyl]piperidine-4-carboxamide.
| Compound Name | N-[2-(butylcarbamoyl)phenyl]-1-[(2,4-dichlorophenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 38097310 |
| Molecular Formula | C24H29Cl2N3O2 |
| Molecular Weight | 462.42 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | N-[2-(butylcarbamoyl)phenyl]-1-[(2,4-dichlorophenyl)methyl]piperidine-4-carboxamide |
| SMILES | CCCCNC(=O)c1ccccc1NC(=O)C1CCN(Cc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C24H29Cl2N3O2/c1-2-3-12-27-24(31)20-6-4-5-7-22(20)28-23(30)17-10-13-29(14-11-17)16-18-8-9-19(25)15-21(18)26/h4-9,15,17H,2-3,10-14,16H2,1H3,(H,27,31)(H,28,30) |
| InChIKey | BFGPIXATJGDPQK-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.42 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|