C23H25ClFN3O2 — CID 100685415
1-[(4-chloro-2-fluorophenyl)methyl]-N-[2-(prop-2-enylcarbamoyl)phenyl]piperidine-4-carboxamide (PubChem CID 100685415) has the molecular formula C23H25ClFN3O2 and a molecular weight of 429.92 g/mol. Its IUPAC name is 1-[(4-chloro-2-fluorophenyl)methyl]-N-[2-(prop-2-enylcarbamoyl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-[(4-chloro-2-fluorophenyl)methyl]-N-[2-(prop-2-enylcarbamoyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 100685415 |
| Molecular Formula | C23H25ClFN3O2 |
| Molecular Weight | 429.92 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 1-[(4-chloro-2-fluorophenyl)methyl]-N-[2-(prop-2-enylcarbamoyl)phenyl]piperidine-4-carboxamide |
| SMILES | C=CCNC(=O)c1ccccc1NC(=O)C1CCN(Cc2ccc(Cl)cc2F)CC1 |
| InChI | InChI=1S/C23H25ClFN3O2/c1-2-11-26-23(30)19-5-3-4-6-21(19)27-22(29)16-9-12-28(13-10-16)15-17-7-8-18(24)14-20(17)25/h2-8,14,16H,1,9-13,15H2,(H,26,30)(H,27,29) |
| InChIKey | HPSJQVJNKQOACP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.92 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|