C23H19F2N3O5 — CID 38134685
2-[[2-(2-benzyl-4-nitrophenoxy)acetyl]amino]-N-(3,4-difluorophenyl)acetamide (PubChem CID 38134685) has the molecular formula C23H19F2N3O5 and a molecular weight of 455.42 g/mol. Its IUPAC name is 2-[[2-(2-benzyl-4-nitrophenoxy)acetyl]amino]-N-(3,4-difluorophenyl)acetamide.
| Compound Name | 2-[[2-(2-benzyl-4-nitrophenoxy)acetyl]amino]-N-(3,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 38134685 |
| Molecular Formula | C23H19F2N3O5 |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 2-[[2-(2-benzyl-4-nitrophenoxy)acetyl]amino]-N-(3,4-difluorophenyl)acetamide |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1Cc1ccccc1)NCC(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C23H19F2N3O5/c24-19-8-6-17(12-20(19)25)27-22(29)13-26-23(30)14-33-21-9-7-18(28(31)32)11-16(21)10-15-4-2-1-3-5-15/h1-9,11-12H,10,13-14H2,(H,26,30)(H,27,29) |
| InChIKey | IIHQDVUIKPLXHD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|