C17H18Cl2N2O2 — CID 38149207
1-[(1S)-1-(2,4-dichlorophenyl)ethyl]-3-[(2-methoxyphenyl)methyl]urea (PubChem CID 38149207) has the molecular formula C17H18Cl2N2O2 and a molecular weight of 353.25 g/mol. Its IUPAC name is 1-[(1S)-1-(2,4-dichlorophenyl)ethyl]-3-[(2-methoxyphenyl)methyl]urea.
| Compound Name | 1-[(1S)-1-(2,4-dichlorophenyl)ethyl]-3-[(2-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 38149207 |
| Molecular Formula | C17H18Cl2N2O2 |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 1-[(1S)-1-(2,4-dichlorophenyl)ethyl]-3-[(2-methoxyphenyl)methyl]urea |
| SMILES | COc1ccccc1CNC(=O)N[C@@H](C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H18Cl2N2O2/c1-11(14-8-7-13(18)9-15(14)19)21-17(22)20-10-12-5-3-4-6-16(12)23-2/h3-9,11H,10H2,1-2H3,(H2,20,21,22)/t11-/m0/s1 |
| InChIKey | SCYOCNYMYLYEAQ-NSHDSACASA-N |
| XLogP | 4.56 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |