C22H22N2O6 — CID 3821447
[2-(3-methoxyphenyl)-2-oxoethyl] 1-[(3-methylbenzoyl)amino]-5-oxopyrrolidine-3-carboxylate (PubChem CID 3821447) has the molecular formula C22H22N2O6 and a molecular weight of 410.43 g/mol. Its IUPAC name is [2-(3-methoxyphenyl)-2-oxoethyl] 1-[(3-methylbenzoyl)amino]-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-(3-methoxyphenyl)-2-oxoethyl] 1-[(3-methylbenzoyl)amino]-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 3821447 |
| Molecular Formula | C22H22N2O6 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | [2-(3-methoxyphenyl)-2-oxoethyl] 1-[(3-methylbenzoyl)amino]-5-oxopyrrolidine-3-carboxylate |
| SMILES | COc1cccc(C(=O)COC(=O)C2CC(=O)N(NC(=O)c3cccc(C)c3)C2)c1 |
| InChI | InChI=1S/C22H22N2O6/c1-14-5-3-7-16(9-14)21(27)23-24-12-17(11-20(24)26)22(28)30-13-19(25)15-6-4-8-18(10-15)29-2/h3-10,17H,11-13H2,1-2H3,(H,23,27) |
| InChIKey | XPKHZDDQQZUJPW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |