C24H24F2N4O4 — CID 3822473
7-[2,3-bis[(4-fluorophenyl)methoxy]propyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 3822473) has the molecular formula C24H24F2N4O4 and a molecular weight of 470.48 g/mol. Its IUPAC name is 7-[2,3-bis[(4-fluorophenyl)methoxy]propyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[2,3-bis[(4-fluorophenyl)methoxy]propyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 3822473 |
| Molecular Formula | C24H24F2N4O4 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 7-[2,3-bis[(4-fluorophenyl)methoxy]propyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CC(COCc2ccc(F)cc2)OCc2ccc(F)cc2)n(C)c1=O |
| InChI | InChI=1S/C24H24F2N4O4/c1-28-22-21(23(31)29(2)24(28)32)30(15-27-22)11-20(34-13-17-5-9-19(26)10-6-17)14-33-12-16-3-7-18(25)8-4-16/h3-10,15,20H,11-14H2,1-2H3 |
| InChIKey | YDJULFYWQYMWLX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |