C16H19FN4O — CID 38234865
1-[(3-fluoro-4-methylphenyl)methyl]-3-[2-(pyridin-2-ylamino)ethyl]urea (PubChem CID 38234865) has the molecular formula C16H19FN4O and a molecular weight of 302.35 g/mol. Its IUPAC name is 1-[(3-fluoro-4-methylphenyl)methyl]-3-[2-(pyridin-2-ylamino)ethyl]urea.
| Compound Name | 1-[(3-fluoro-4-methylphenyl)methyl]-3-[2-(pyridin-2-ylamino)ethyl]urea |
|---|---|
| PubChem CID | 38234865 |
| Molecular Formula | C16H19FN4O |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 1-[(3-fluoro-4-methylphenyl)methyl]-3-[2-(pyridin-2-ylamino)ethyl]urea |
| SMILES | Cc1ccc(CNC(=O)NCCNc2ccccn2)cc1F |
| InChI | InChI=1S/C16H19FN4O/c1-12-5-6-13(10-14(12)17)11-21-16(22)20-9-8-19-15-4-2-3-7-18-15/h2-7,10H,8-9,11H2,1H3,(H,18,19)(H2,20,21,22) |
| InChIKey | KOMIKKCVFYNYDL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|