C13H12ClF3N6O2S — CID 3824235
1-amino-2-(benzenesulfonyl)-3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]guanidine (PubChem CID 3824235) has the molecular formula C13H12ClF3N6O2S and a molecular weight of 408.79 g/mol. Its IUPAC name is 1-amino-2-(benzenesulfonyl)-3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]guanidine.
| Compound Name | 1-amino-2-(benzenesulfonyl)-3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]guanidine |
|---|---|
| PubChem CID | 3824235 |
| Molecular Formula | C13H12ClF3N6O2S |
| Molecular Weight | 408.79 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 1-amino-2-(benzenesulfonyl)-3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]guanidine |
| SMILES | NNC(=NS(=O)(=O)c1ccccc1)NNc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H12ClF3N6O2S/c14-10-6-8(13(15,16)17)7-19-11(10)21-22-12(20-18)23-26(24,25)9-4-2-1-3-5-9/h1-7H,18H2,(H,19,21)(H2,20,22,23) |
| InChIKey | QQDNWHJDHXFAOQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 121.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.79 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|