C17H17ClFNO4S2 — CID 3825088
methyl 3-benzylsulfanyl-2-[(3-chloro-4-fluorophenyl)sulfonylamino]propanoate (PubChem CID 3825088) has the molecular formula C17H17ClFNO4S2 and a molecular weight of 417.91 g/mol. Its IUPAC name is methyl 3-benzylsulfanyl-2-[(3-chloro-4-fluorophenyl)sulfonylamino]propanoate.
| Compound Name | methyl 3-benzylsulfanyl-2-[(3-chloro-4-fluorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 3825088 |
| Molecular Formula | C17H17ClFNO4S2 |
| Molecular Weight | 417.91 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | methyl 3-benzylsulfanyl-2-[(3-chloro-4-fluorophenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)C(CSCc1ccccc1)NS(=O)(=O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C17H17ClFNO4S2/c1-24-17(21)16(11-25-10-12-5-3-2-4-6-12)20-26(22,23)13-7-8-15(19)14(18)9-13/h2-9,16,20H,10-11H2,1H3 |
| InChIKey | IDIFRDHGKVHYFF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.91 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |