C21H22N4O2S — CID 3825194
4-(2-oxo-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazol-1-yl)-N-pyridin-3-ylpiperidine-1-carbothioamide (PubChem CID 3825194) has the molecular formula C21H22N4O2S and a molecular weight of 394.50 g/mol. Its IUPAC name is 4-(2-oxo-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazol-1-yl)-N-pyridin-3-ylpiperidine-1-carbothioamide.
| Compound Name | 4-(2-oxo-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazol-1-yl)-N-pyridin-3-ylpiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3825194 |
| Molecular Formula | C21H22N4O2S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 4-(2-oxo-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazol-1-yl)-N-pyridin-3-ylpiperidine-1-carbothioamide |
| SMILES | O=C1OC2Cc3ccccc3C2N1C1CCN(C(=S)Nc2cccnc2)CC1 |
| InChI | InChI=1S/C21H22N4O2S/c26-21-25(19-17-6-2-1-4-14(17)12-18(19)27-21)16-7-10-24(11-8-16)20(28)23-15-5-3-9-22-13-15/h1-6,9,13,16,18-19H,7-8,10-12H2,(H,23,28) |
| InChIKey | YNMDCZZCAYNWEQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|