C26H31N3O5S — CID 3806442
4-(2-oxo-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazol-1-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]piperidine-1-carbothioamide (PubChem CID 3806442) has the molecular formula C26H31N3O5S and a molecular weight of 497.62 g/mol. Its IUPAC name is 4-(2-oxo-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazol-1-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]piperidine-1-carbothioamide.
| Compound Name | 4-(2-oxo-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazol-1-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3806442 |
| Molecular Formula | C26H31N3O5S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 4-(2-oxo-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazol-1-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]piperidine-1-carbothioamide |
| SMILES | COc1cc(CNC(=S)N2CCC(N3C(=O)OC4Cc5ccccc5C43)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C26H31N3O5S/c1-31-21-12-16(13-22(32-2)24(21)33-3)15-27-25(35)28-10-8-18(9-11-28)29-23-19-7-5-4-6-17(19)14-20(23)34-26(29)30/h4-7,12-13,18,20,23H,8-11,14-15H2,1-3H3,(H,27,35) |
| InChIKey | FVJLEWQKPHBXNE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|