C22H21ClFN5O3S2 — CID 3825262
N'-[2-[1-(2-chloro-6-fluorobenzoyl)piperidin-4-yl]-1,3-thiazole-4-carbonyl]-2,4-dimethyl-1,3-thiazole-5-carbohydrazide (PubChem CID 3825262) has the molecular formula C22H21ClFN5O3S2 and a molecular weight of 522.03 g/mol. Its IUPAC name is N'-[2-[1-(2-chloro-6-fluorobenzoyl)piperidin-4-yl]-1,3-thiazole-4-carbonyl]-2,4-dimethyl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-[2-[1-(2-chloro-6-fluorobenzoyl)piperidin-4-yl]-1,3-thiazole-4-carbonyl]-2,4-dimethyl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 3825262 |
| Molecular Formula | C22H21ClFN5O3S2 |
| Molecular Weight | 522.03 g/mol |
| Exact Mass | 521.08 |
| IUPAC Name | N'-[2-[1-(2-chloro-6-fluorobenzoyl)piperidin-4-yl]-1,3-thiazole-4-carbonyl]-2,4-dimethyl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(C)c(C(=O)NNC(=O)c2csc(C3CCN(C(=O)c4c(F)cccc4Cl)CC3)n2)s1 |
| InChI | InChI=1S/C22H21ClFN5O3S2/c1-11-18(34-12(2)25-11)20(31)28-27-19(30)16-10-33-21(26-16)13-6-8-29(9-7-13)22(32)17-14(23)4-3-5-15(17)24/h3-5,10,13H,6-9H2,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | ZFIXLQUVKZEANK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.03 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|