C22H23ClFN5O4S — CID 3781424
2-[1-(2-chloro-6-fluorobenzoyl)piperidin-4-yl]-N'-(2-oxopiperidine-3-carbonyl)-1,3-thiazole-4-carbohydrazide (PubChem CID 3781424) has the molecular formula C22H23ClFN5O4S and a molecular weight of 507.98 g/mol. Its IUPAC name is 2-[1-(2-chloro-6-fluorobenzoyl)piperidin-4-yl]-N'-(2-oxopiperidine-3-carbonyl)-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-[1-(2-chloro-6-fluorobenzoyl)piperidin-4-yl]-N'-(2-oxopiperidine-3-carbonyl)-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 3781424 |
| Molecular Formula | C22H23ClFN5O4S |
| Molecular Weight | 507.98 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | 2-[1-(2-chloro-6-fluorobenzoyl)piperidin-4-yl]-N'-(2-oxopiperidine-3-carbonyl)-1,3-thiazole-4-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCCNC1=O)c1csc(C2CCN(C(=O)c3c(F)cccc3Cl)CC2)n1 |
| InChI | InChI=1S/C22H23ClFN5O4S/c23-14-4-1-5-15(24)17(14)22(33)29-9-6-12(7-10-29)21-26-16(11-34-21)20(32)28-27-19(31)13-3-2-8-25-18(13)30/h1,4-5,11-13H,2-3,6-10H2,(H,25,30)(H,27,31)(H,28,32) |
| InChIKey | MCNWUTXVEIMOAL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.98 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|