C12H5Cl3O2 — CID 38253
1,2,4-Trichlorodibenzo(b,e)(1,4)dioxin (PubChem CID 38253) has the molecular formula C12H5Cl3O2 and a molecular weight of 287.50 g/mol. Its IUPAC name is 1,2,4-trichlorodibenzo-p-dioxin.
| Compound Name | 1,2,4-Trichlorodibenzo(b,e)(1,4)dioxin |
|---|---|
| PubChem CID | 38253 |
| Molecular Formula | C12H5Cl3O2 |
| Molecular Weight | 287.50 g/mol |
| Exact Mass | 285.94 |
| IUPAC Name | 1,2,4-trichlorodibenzo-p-dioxin |
| SMILES | C1=CC=C2C(=C1)OC3=C(O2)C(=C(C=C3Cl)Cl)Cl |
| InChI | InChI=1S/C12H5Cl3O2/c13-6-5-7(14)11-12(10(6)15)17-9-4-2-1-3-8(9)16-11/h1-5H |
| InChIKey | HRVUKLBFRPWXPJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 18.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | 289 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|