C15H17NO4S3 — CID 38256835
N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 38256835) has the molecular formula C15H17NO4S3 and a molecular weight of 371.51 g/mol. Its IUPAC name is N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 38256835 |
| Molecular Formula | C15H17NO4S3 |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | O=S(=O)(NCCSCc1ccsc1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C15H17NO4S3/c17-23(18,16-4-8-22-11-12-3-7-21-10-12)13-1-2-14-15(9-13)20-6-5-19-14/h1-3,7,9-10,16H,4-6,8,11H2 |
| InChIKey | ANLLKICQGQOLKJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|