C21H22F3N3O5S — CID 38258813
4-[4-(benzenesulfonyl)piperazin-1-yl]-4-oxo-N-[3-(trifluoromethoxy)phenyl]butanamide (PubChem CID 38258813) has the molecular formula C21H22F3N3O5S and a molecular weight of 485.48 g/mol. Its IUPAC name is 4-[4-(benzenesulfonyl)piperazin-1-yl]-4-oxo-N-[3-(trifluoromethoxy)phenyl]butanamide.
| Compound Name | 4-[4-(benzenesulfonyl)piperazin-1-yl]-4-oxo-N-[3-(trifluoromethoxy)phenyl]butanamide |
|---|---|
| PubChem CID | 38258813 |
| Molecular Formula | C21H22F3N3O5S |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 4-[4-(benzenesulfonyl)piperazin-1-yl]-4-oxo-N-[3-(trifluoromethoxy)phenyl]butanamide |
| SMILES | O=C(CCC(=O)N1CCN(S(=O)(=O)c2ccccc2)CC1)Nc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C21H22F3N3O5S/c22-21(23,24)32-17-6-4-5-16(15-17)25-19(28)9-10-20(29)26-11-13-27(14-12-26)33(30,31)18-7-2-1-3-8-18/h1-8,15H,9-14H2,(H,25,28) |
| InChIKey | GDOITZWORQYEFT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |