C20H21Cl2N3O4S — CID 26577423
4-[4-(benzenesulfonyl)piperazin-1-yl]-N-(3,4-dichlorophenyl)-4-oxobutanamide (PubChem CID 26577423) has the molecular formula C20H21Cl2N3O4S and a molecular weight of 470.38 g/mol. Its IUPAC name is 4-[4-(benzenesulfonyl)piperazin-1-yl]-N-(3,4-dichlorophenyl)-4-oxobutanamide.
| Compound Name | 4-[4-(benzenesulfonyl)piperazin-1-yl]-N-(3,4-dichlorophenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 26577423 |
| Molecular Formula | C20H21Cl2N3O4S |
| Molecular Weight | 470.38 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | 4-[4-(benzenesulfonyl)piperazin-1-yl]-N-(3,4-dichlorophenyl)-4-oxobutanamide |
| SMILES | O=C(CCC(=O)N1CCN(S(=O)(=O)c2ccccc2)CC1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H21Cl2N3O4S/c21-17-7-6-15(14-18(17)22)23-19(26)8-9-20(27)24-10-12-25(13-11-24)30(28,29)16-4-2-1-3-5-16/h1-7,14H,8-13H2,(H,23,26) |
| InChIKey | YCOLFRWJYNNLEJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |