C10H13N5 — CID 3826763
N,N-dimethyl-1-(1-phenyltetrazol-5-yl)methanamine (PubChem CID 3826763) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is N,N-dimethyl-1-(1-phenyltetrazol-5-yl)methanamine.
| Compound Name | N,N-dimethyl-1-(1-phenyltetrazol-5-yl)methanamine |
|---|---|
| PubChem CID | 3826763 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | N,N-dimethyl-1-(1-phenyltetrazol-5-yl)methanamine |
| SMILES | CN(C)Cc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C10H13N5/c1-14(2)8-10-11-12-13-15(10)9-6-4-3-5-7-9/h3-7H,8H2,1-2H3 |
| InChIKey | NURBHWJLXRGKTK-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |