C14H14N6 — CID 3074553
[1-[(2-phenyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-2-ylidene]cyanamide (PubChem CID 3074553) has the molecular formula C14H14N6 and a molecular weight of 266.31 g/mol. Its IUPAC name is [1-[(2-phenyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-2-ylidene]cyanamide.
| Compound Name | [1-[(2-phenyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-2-ylidene]cyanamide |
|---|---|
| PubChem CID | 3074553 |
| Molecular Formula | C14H14N6 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | [1-[(2-phenyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-2-ylidene]cyanamide |
| SMILES | N#C/N=C1\CCCN1Cc1ncnn1-c1ccccc1 |
| InChI | InChI=1S/C14H14N6/c15-10-16-13-7-4-8-19(13)9-14-17-11-18-20(14)12-5-2-1-3-6-12/h1-3,5-6,11H,4,7-9H2/b16-13+ |
| InChIKey | CIWIVNUSRREKAV-DTQAZKPQSA-N |
| XLogP | 1.74 |
| TPSA | 70.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|