C13H14N4O — CID 645891
1-[(2-phenyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-2-one (PubChem CID 645891) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is 1-[(2-phenyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-2-one.
| Compound Name | 1-[(2-phenyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 645891 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1-[(2-phenyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1Cc1ncnn1-c1ccccc1 |
| InChI | InChI=1S/C13H14N4O/c18-13-7-4-8-16(13)9-12-14-10-15-17(12)11-5-2-1-3-6-11/h1-3,5-6,10H,4,7-9H2 |
| InChIKey | VQUHWQZLHDKXLR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |