C10H17ClN2O2 — CID 3827198
2-chloro-N-(cyclohexylcarbamoyl)propanamide (PubChem CID 3827198) has the molecular formula C10H17ClN2O2 and a molecular weight of 232.71 g/mol. Its IUPAC name is 2-chloro-N-(cyclohexylcarbamoyl)propanamide.
| Compound Name | 2-chloro-N-(cyclohexylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 3827198 |
| Molecular Formula | C10H17ClN2O2 |
| Molecular Weight | 232.71 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 2-chloro-N-(cyclohexylcarbamoyl)propanamide |
| SMILES | CC(Cl)C(=O)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C10H17ClN2O2/c1-7(11)9(14)13-10(15)12-8-5-3-2-4-6-8/h7-8H,2-6H2,1H3,(H2,12,13,14,15) |
| InChIKey | OQFYKJXOOAHKPK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.71 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|