C25H26N6O3S — CID 3827500
2-[1-[2-(1H-indol-3-yl)acetyl]piperidin-4-yl]-N'-(1-methylpyrrole-2-carbonyl)-1,3-thiazole-4-carbohydrazide (PubChem CID 3827500) has the molecular formula C25H26N6O3S and a molecular weight of 490.59 g/mol. Its IUPAC name is 2-[1-[2-(1H-indol-3-yl)acetyl]piperidin-4-yl]-N'-(1-methylpyrrole-2-carbonyl)-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-[1-[2-(1H-indol-3-yl)acetyl]piperidin-4-yl]-N'-(1-methylpyrrole-2-carbonyl)-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 3827500 |
| Molecular Formula | C25H26N6O3S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 2-[1-[2-(1H-indol-3-yl)acetyl]piperidin-4-yl]-N'-(1-methylpyrrole-2-carbonyl)-1,3-thiazole-4-carbohydrazide |
| SMILES | Cn1cccc1C(=O)NNC(=O)c1csc(C2CCN(C(=O)Cc3c[nH]c4ccccc34)CC2)n1 |
| InChI | InChI=1S/C25H26N6O3S/c1-30-10-4-7-21(30)24(34)29-28-23(33)20-15-35-25(27-20)16-8-11-31(12-9-16)22(32)13-17-14-26-19-6-3-2-5-18(17)19/h2-7,10,14-16,26H,8-9,11-13H2,1H3,(H,28,33)(H,29,34) |
| InChIKey | DIPUXDZDILJXHV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 112.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|