C29H25BrO2 — CID 3828041
ethyl 3-[4-(4-bromophenyl)-2,6-diphenylphenyl]propanoate (PubChem CID 3828041) has the molecular formula C29H25BrO2 and a molecular weight of 485.42 g/mol. Its IUPAC name is ethyl 3-[4-(4-bromophenyl)-2,6-diphenylphenyl]propanoate.
| Compound Name | ethyl 3-[4-(4-bromophenyl)-2,6-diphenylphenyl]propanoate |
|---|---|
| PubChem CID | 3828041 |
| Molecular Formula | C29H25BrO2 |
| Molecular Weight | 485.42 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | ethyl 3-[4-(4-bromophenyl)-2,6-diphenylphenyl]propanoate |
| SMILES | CCOC(=O)CCc1c(-c2ccccc2)cc(-c2ccc(Br)cc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C29H25BrO2/c1-2-32-29(31)18-17-26-27(22-9-5-3-6-10-22)19-24(21-13-15-25(30)16-14-21)20-28(26)23-11-7-4-8-12-23/h3-16,19-20H,2,17-18H2,1H3 |
| InChIKey | CUXPLOKWVYOLAZ-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.42 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |