C14H11BrN2OS — CID 3830955
1-(4-bromo-6-ethyl-1,3-benzothiazol-2-yl)pyrrole-2-carbaldehyde (PubChem CID 3830955) has the molecular formula C14H11BrN2OS and a molecular weight of 335.23 g/mol. Its IUPAC name is 1-(4-bromo-6-ethyl-1,3-benzothiazol-2-yl)pyrrole-2-carbaldehyde.
| Compound Name | 1-(4-bromo-6-ethyl-1,3-benzothiazol-2-yl)pyrrole-2-carbaldehyde |
|---|---|
| PubChem CID | 3830955 |
| Molecular Formula | C14H11BrN2OS |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | 1-(4-bromo-6-ethyl-1,3-benzothiazol-2-yl)pyrrole-2-carbaldehyde |
| SMILES | CCc1cc(Br)c2nc(-n3cccc3C=O)sc2c1 |
| InChI | InChI=1S/C14H11BrN2OS/c1-2-9-6-11(15)13-12(7-9)19-14(16-13)17-5-3-4-10(17)8-18/h3-8H,2H2,1H3 |
| InChIKey | YMOATLNKYZZSGU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|