C28H34N2O5 — CID 3831565
4-[4-[[4-(5-hex-1-ynylpyridine-3-carbonyl)morpholin-2-yl]methoxy]-3-methoxyphenyl]butan-2-one (PubChem CID 3831565) has the molecular formula C28H34N2O5 and a molecular weight of 478.59 g/mol. Its IUPAC name is 4-[4-[[4-(5-hex-1-ynylpyridine-3-carbonyl)morpholin-2-yl]methoxy]-3-methoxyphenyl]butan-2-one.
| Compound Name | 4-[4-[[4-(5-hex-1-ynylpyridine-3-carbonyl)morpholin-2-yl]methoxy]-3-methoxyphenyl]butan-2-one |
|---|---|
| PubChem CID | 3831565 |
| Molecular Formula | C28H34N2O5 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | 4-[4-[[4-(5-hex-1-ynylpyridine-3-carbonyl)morpholin-2-yl]methoxy]-3-methoxyphenyl]butan-2-one |
| SMILES | CCCCC#Cc1cncc(C(=O)N2CCOC(COc3ccc(CCC(C)=O)cc3OC)C2)c1 |
| InChI | InChI=1S/C28H34N2O5/c1-4-5-6-7-8-23-15-24(18-29-17-23)28(32)30-13-14-34-25(19-30)20-35-26-12-11-22(10-9-21(2)31)16-27(26)33-3/h11-12,15-18,25H,4-6,9-10,13-14,19-20H2,1-3H3 |
| InChIKey | VPNBBJRKYPCEJO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|