C25H27ClN2O4 — CID 3355202
1-[5-chloro-2-[[4-(5-hex-1-ynylpyridine-3-carbonyl)morpholin-2-yl]methoxy]phenyl]ethanone (PubChem CID 3355202) has the molecular formula C25H27ClN2O4 and a molecular weight of 454.95 g/mol. Its IUPAC name is 1-[5-chloro-2-[[4-(5-hex-1-ynylpyridine-3-carbonyl)morpholin-2-yl]methoxy]phenyl]ethanone.
| Compound Name | 1-[5-chloro-2-[[4-(5-hex-1-ynylpyridine-3-carbonyl)morpholin-2-yl]methoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 3355202 |
| Molecular Formula | C25H27ClN2O4 |
| Molecular Weight | 454.95 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 1-[5-chloro-2-[[4-(5-hex-1-ynylpyridine-3-carbonyl)morpholin-2-yl]methoxy]phenyl]ethanone |
| SMILES | CCCCC#Cc1cncc(C(=O)N2CCOC(COc3ccc(Cl)cc3C(C)=O)C2)c1 |
| InChI | InChI=1S/C25H27ClN2O4/c1-3-4-5-6-7-19-12-20(15-27-14-19)25(30)28-10-11-31-22(16-28)17-32-24-9-8-21(26)13-23(24)18(2)29/h8-9,12-15,22H,3-5,10-11,16-17H2,1-2H3 |
| InChIKey | GFRHLZYQCKJYMW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.95 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|