C18H19ClF2N2O3 — CID 38326031
1-[(3-chlorophenyl)methyl]-3-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-1-methylurea (PubChem CID 38326031) has the molecular formula C18H19ClF2N2O3 and a molecular weight of 384.81 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-3-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-1-methylurea.
| Compound Name | 1-[(3-chlorophenyl)methyl]-3-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-1-methylurea |
|---|---|
| PubChem CID | 38326031 |
| Molecular Formula | C18H19ClF2N2O3 |
| Molecular Weight | 384.81 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-3-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-1-methylurea |
| SMILES | COc1ccc(CNC(=O)N(C)Cc2cccc(Cl)c2)cc1OC(F)F |
| InChI | InChI=1S/C18H19ClF2N2O3/c1-23(11-13-4-3-5-14(19)8-13)18(24)22-10-12-6-7-15(25-2)16(9-12)26-17(20)21/h3-9,17H,10-11H2,1-2H3,(H,22,24) |
| InChIKey | UXOGWPBKCNTZNZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.81 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |