C21H18N4O5S — CID 38333241
N-[4-[2-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]anilino]-2-oxoethyl]-1,3-thiazol-2-yl]furan-2-carboxamide (PubChem CID 38333241) has the molecular formula C21H18N4O5S and a molecular weight of 438.47 g/mol. Its IUPAC name is N-[4-[2-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]anilino]-2-oxoethyl]-1,3-thiazol-2-yl]furan-2-carboxamide.
| Compound Name | N-[4-[2-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]anilino]-2-oxoethyl]-1,3-thiazol-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 38333241 |
| Molecular Formula | C21H18N4O5S |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | N-[4-[2-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]anilino]-2-oxoethyl]-1,3-thiazol-2-yl]furan-2-carboxamide |
| SMILES | O=C(Cc1csc(NC(=O)c2ccco2)n1)Nc1ccc(CN2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C21H18N4O5S/c26-17(10-15-12-31-21(23-15)24-20(29)16-2-1-9-30-16)22-14-5-3-13(4-6-14)11-25-18(27)7-8-19(25)28/h1-6,9,12H,7-8,10-11H2,(H,22,26)(H,23,24,29) |
| InChIKey | JKUNGPVLOMWEGY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|